ChemNet > CAS > 1723-27-9 thieno[3,2-b]thiophene-2-carboxylic acid
1723-27-9 thieno[3,2-b]thiophene-2-carboxylic acid
Ürün Adı |
thieno[3,2-b]thiophene-2-carboxylic acid |
Moleküler Formülü |
C7H4O2S2 |
Molekül Ağırlığı |
184.2355 |
InChI |
InChI=1/C7H4O2S2/c8-7(9)6-3-5-4(11-6)1-2-10-5/h1-3H,(H,8,9) |
CAS kayıt numarası |
1723-27-9 |
Moleküler Yapısı |
|
Yoğunluk |
1.601g/cm3 |
Ergime noktası |
218℃ |
Kaynama noktası |
386.7°C at 760 mmHg |
Kırılma indisi |
1.769 |
Alevlenme noktası |
187.6°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|